Phương pháp giải những dạng bài tập chương Hidrocacbon không no

Với phương thức giải những dạng bài tập chương Hidrocacbon ko no Hoá học tập lớp 11 tổng hợp các dạng bài xích tập, bài bác tập trắc nghiệm tất cả lời giải chi tiết với đầy đủ phương pháp giải, lấy ví dụ minh họa để giúp học sinh ôn tập, biết cách làm dạng bài bác tập chương Hidrocacbon không no từ đó đạt điểm trên cao trong bài xích thi môn Hoá học tập lớp 11.

Bạn đang xem: Các dạng bài tập anken

*

Bài tập trắc nghiệm

Bài tập đặc thù hóa học tập của Anken, Ankađien, Ankin

Bài 1: Theo quy tắc cộng Maccopnhicop, propen phản nghịch ứng cùng với HCl, nhận được sản phẩm chính là

A. 1-Clpropan B. propan

C. 2-Clopropan D. 1,2-điClopropan.

Hiển thị đáp án

Đáp án: C

Bài 2: chất nào sau đây làm mất màu nước brom?

A. propan B. metan C. propen D. cacbonđioxit

Hiển thị đáp án

Đáp án: C

Anken làm mất đi màu nước brom cho nên người ta sử dụng nước brom hoặc dd brom vào CCl4 làm thuốc thử nhận biết anken

Bài 3: Hiđro hóa hoàn toàn buta-1,3-đien, chiếm được

A. butan B. isobutan

C. isopentan D. pentan

Hiển thị đáp án

Đáp án: A

Bài 4: lựa chọn câu trả lời đúng :

A. Anken là số đông hydrocacbon mà phân tử bao gồm chứa một link đôi C=C

B. Anken là đầy đủ hydrocacbon nhưng CTPT tất cả dạng CnH2n, n ≥ 2, nguyên.

C. Anken là đa số hydrocacbon ko no có CTPT CnH2n, n ≥ 2, nguyên.

D. Anken là đa số hydrocacbon mạch hở mà lại phân tử tất cả chứa một link đôi C=C

Hiển thị đáp án

Đáp án: D

Bài 5: Điều kiện nhằm anken bao gồm đồng phân hình học?

A. mỗi ngtử cacbon ở links đôi liên kết với cùng 1 ngtử hoặc đội ngtử như là nhau.

B. từng ngtử cacbon ở liên kết đôi link với 2 ngtử hoặc đội ngtử khác nhau.

C. từng ngtử cacbon ở liên kết đôi liên kết với 2 ngtử hoặc nhóm ngtử tương đương nhau.

D. từng ngtử cacbon ở liên kết đôi liên kết với một ngtử hoặc team ngtử không giống nhau.

Hiển thị đáp án

Đáp án: B

Bài 6: Áp dụng luật lệ Maccopnhicop vào trường hòa hợp nào tiếp sau đây ?

A. bội phản ứng cộng của Br2 cùng với anken đối xứng.

C. làm phản ứng cùng của HX vào anken đối xứng.

B. phản ứng trùng hợp của anken.

D. bội phản ứng cộng của HX vào anken bất đối xứng.

Hiển thị đáp án

Đáp án: D

Bài 7: Monome của thành phầm trùng hợp mang tên gọi là polipropilen (P.P) là:

A. (- CH2-CH2-)n B. (-CH2(CH3)-CH-)n

C. CH2 =CH2 D. CH2=CH-CH3

Hiển thị đáp án

Đáp án: D

Bài 8: kết luận nào sau đây là không đúng ?

A. Ankađien là đông đảo HRC không no mạch hở, phân tử bao gồm hai liên kết đôi C=C

B. Ankađien có chức năng cộng đúng theo hai phân tử hiđro.

C. phần đa hợp chất có khả năng cộng phù hợp hai phân tử hiđro thuộc nhiều loại ankađien.

D. đa số hiđrocacbon ko no mạch hở, phân tử gồm hai link đôi giải pháp nhau một links đơn được gọi là ankađien liên hợp.

Hiển thị đáp án

Đáp án: C

Bài 9: cao su buna là thành phầm có thành phần đó là polime thu được từ quy trình

A. Trùng hợp butilen, xúc tác natri.

B. Trùng vừa lòng buta –1,3– đien, xúc tác natri.

C. Polime hoá cao su thiên nhiên thiên nhiên.

D. Đồng trùng phù hợp buta –1,3– đien với natri.

Hiển thị đáp án

Đáp án: B

Bài 10: hóa học nào không chức năng với hỗn hợp AgNO3/NH3 ?

A. But-1-in B. But-2-in C. Etin D. Propin

Hiển thị đáp án

Đáp án: B

Akin gồm nối 3 đầu mạch mới tác dụng với dung dịch AgNO3/NH3

Bài 11: Công thức tổng quát của Anken là:

A. CnH2n+2(n ≥ 0) B.CnH2n(n ≥ 2)

C. CnH2n (n ≥ 3) D.CnH2n-6(n ≥ 6)

Hiển thị đáp án

Đáp án: B

Bài 12: mang đến phản ứng giữa buta-1,3-đi en với HBr làm việc -80°C (tỉ lệ mol 1 : 1), thành phầm chính của phản bội ứng là

A. CH3CHBrCH=CH2 B. CH3CH=CHCH2Br

C. CH2BrCH2CH=CH2 D.CH2CH=CBr CH3

Hiển thị đáp án

Đáp án: A

Bài 13: Số links σ trong một phân tử buta-1,2- đien là

A.8 B. 7 C. 6

Hiển thị đáp án

Đáp án: D

Bài 14: Trùng phù hợp eten, sản phẩm thu được có kết cấu là:

A. (-CH2=CH2-)n . B. (-CH2-CH2-)n.

C. (-CH=CH-)n . D. (-CH3-CH3-)n .

Hiển thị đáp án

Đáp án: B

Bài 15: nhựa P.E(polietilen) được điều chế trực tiếp từ hóa học nào sau đây?

A. C2H2 B. C2H4 C. C2H6 D. Ý kiến khác

Hiển thị đáp án

Đáp án: B

Bài 16: tóm lại nào sau đây là đúng?

A. Ankađien tất cả công thức phân tử dạng CnH2n–2.

B. những hiđrocacbon tất cả công thức phân tử dạng CnH2n–2 đông đảo thuộc nhiều loại ankađien.

C. Ankađien không tồn tại đồng phân hình học.

D. Ankađien phân tử khối mập không tác dụng với brom (trong dung dịch).

Hiển thị đáp án

Đáp án: A

Bài 17: mang lại phản ứng giữa buta-1,3-đien với HBr ngơi nghỉ -80ºC (tỉ lệ mol 1:1), sản phẩm chính của phản bội ứng là

A. CH3CHBrCH=CH2. B. CH3CH=CHCH2Br.

C. CH2BrCH2CH=CH2. D. CH3CH=CBrCH3.

Hiển thị đáp án

Đáp án: A

Bài 18: kết luận nào sau đó là không đúng ?

A. Buta–1,3–đien cùng đồng đẳng bao gồm công thức phân tử tầm thường CxH2x–2 (x ≥ 3).

B. những hiđrocacbon có công thức phân tử dạng CxH2x–2 với x ≥ 3 phần đông thuộc dãy đồng đẳng của ankađien.

C. Buta–1,3–đien là 1 trong những ankađien liên hợp.

D. Trùng vừa lòng buta–1,3–đien (có natri làm cho xúc tác) được cao su buna.

Hiển thị đáp án

Đáp án: B

Bài 19: Hidro hóa trọn vẹn axetilen bằng lượng dư hidro có xúc tác Ni cùng đun rét thu được sản phẩm là?

A. Etylen B. etan C. eten D. etyl

Hiển thị đáp án

Đáp án: B

Bài 20: lúc hidro hoá but-2-in bằng lượng H2 dư cùng với xúc tác là Pd/PbCO3 cho thành phầm chính là:

A. butan B. trans-but-2-en C. Cis-but-2-en D. cả B và C

Hiển thị đáp án

Đáp án: D

Dạng bài xích tập Đồng phân, danh pháp của Anken, Ankađien, Ankin

A. Bài bác tập từ bỏ luận

Bài 1: Viết các đồng phân cấu trúc và hotline tên anken C5H10.

Hướng dẫn:

Các đồng phân cấu tạo anken của C5H10:

CH2=CH-CH2CH2-CH3 (pent-1-en)

CH3CH=CHCH2-CH3 (pent-2-en)

CH2=CH-CH(CH3)-CH3 (3-metylbut-2-en)

CH2=C(CH2)CH2-CH3 (2-metylbut-1-en)

CH3CH=CH(CH3)-CH3 (2-metylbut-2-en)

Bài 2: cho những chất : 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4); 3-metylbut-2-en (5). Viết CTCT của những chất. đầy đủ chất nào là đồng phân của nhau ?

Hướng dẫn:

(1) CH2=C(CH2)CH2-CH3

(2) CH2=CH-C(CH3)2-CH3

(3) CH2=CH-CH(CH3)CH2-CH3

(4) CH3CH=C(CH3)CH2-CH3

(5) CH2=CH-CH(CH3)-CH3

Các hóa học là đồng phân của nhau là: (1) và (5); (2), (3) và (4) .

Bài 3: Viết những đồng phân ankađien phối hợp của C5H8? hotline tên các đồng phân.

Hướng dẫn:

Các đồng phân phối hợp của C5H8:

CH2=CH-CH=CH-CH3 (penta-1,3-đien)

CH2=C(CH3)-CH=CH2 (2-metylpenta-1,3-đien)

Bài 4: Viết CTCT của những chất sau: (1) Buta-1,3-đien, (2) isopren (3) 2,3-đimetylpenta-1,3-đien.

Hướng dẫn:

(1) CH2=CH-CH=CH2 ;

(2) CH2=C(CH3)-CH=CH2;

(3) CH2=C(CH3)-C(CH3)=CH-CH3

Bài 5: Viết những đồng phân ankin của C4H6 và gọi tên. Cho các đồng phân kia với nước brom dư; hiđro dư (xt thứu tự là Ni) cùng AgNO3 trong hỗn hợp NH3 viết PTHH xảy ra.

Hướng dẫn:

Các đồng phân ankin của C4H6 là:

CH≡C-CH2-CH3 (but-1-in); CH3-C≡C-CH3 (but-2-in)

Phương trình phản nghịch ứng:

CH≡C-CH2-CH3 + Br2 → CHBr2-CBr2-CH2-CH3

CH≡C-CH2-CH3 + H2 → CH3-CH2-CH2-CH3

CH≡C-CH2-CH3 + AgNO3 + NH3 → CAg≡C-CH2-CH3 + NH4NO3

CH3-C≡C-CH3+ Br2 → CH3-CBr2-CBr2-CH3

CH3-C≡C-CH3 + H2 → CH3-CH2-CH2-CH3

Bài 6: Viết CTCT những ankin mang tên sau: (1) iso-butylaxetilen, (2) metyl iso-propylaxetilen, (3) 3-metylpen-1-in, (4) 2,2,5,5-tetrametylhex-3-in, (5) xicl-clopropylaxetilen.

Hướng dẫn:

(1) (CH3)2-CH-CH2-C≡CH

(2) CH3-C≡C-CH(CH3)2

(3) CH≡C-CH(CH3)-CH2-CH3

(4) CH3-C(CH3)2-C≡C-C(CH3)2-CH3

(5)

*

B. Bài tập trắc nghiệm

Bài 1: tên theo danh pháp quốc tế của chất (CH3)2CHCH=CHCH3 là:

A.1-Metyl-2-isopropyleten B.1,1-Đimetylbut-2-en

C. 1-Isopropylpropen D.4-Metylpent-2-en.

Lời giải:

Đáp án: D

Bài 2: Hợp chất C5H10 có bao nhiêu đồng phân anken ?

A. 4. B. 5. C. 6. D. 7.

Lời giải:

Đáp án: D

5 đồng phân cấu tạo và 2 đồng phân cis – trans

Bài 3: Anken có đồng phân hình học ?

A.Pent-1-en. B. Pent-2-en.

C. 2-metylbut-2-en. D. 3-metylbut-1-en.

Lời giải:

Đáp án: B

CTCT: CH3CH=CHCH2-CH3

Bài 4: cho các chất sau:

(1) CH2=CHCH2CH2CH=CH2; (2) CH2=CHCH=CHCH2CH3;

(3) CH3C(CH3)=CHCH2;(4) CH2=CHCH2CH=CH2;

(5) CH3CH2CH=CHCH2CH3;(6) CH3C(CH3)=CH2;

(7) CH3CH2C(CH3)=C(C2H5)CH(CH3)2; (8) CH3CH=CHCH3.

Số chất bao gồm đồng phân hình học tập là:

A. 4. B. 1. C. 2. D. 3.

Lời giải:

Đáp án: A

2,5,7,8

Bài 5: Số đồng phân cấu tạo thuộc các loại ankađien ứng với công thức phân tử C5H8 là:

A. 4. B. 5. C. 6. D. 7.

Lời giải:

Đáp án: B

Bài 6: Ankađien X bao gồm CTCT: CH3-CH=CH-CH(CH3)-CH=CH2. X có tên thay nắm là.

A. 4-metylhexa-2,5-đien B. 3-metylhexa-1,4-đien

C. 3-metylhexa-2,4-đien D. A, B, C đa số sai.

Lời giải:

Đáp án: B

Bài 7: Hợp hóa học CH3CH=CHC(CH3)2CH=CH2 mang tên thay thế là:

A. 4,4-đimetylhexa-2,4-đien B. 3,3-đimetylhexa-1,4-đien

C. 3,4-đimetylhexa-1,4-đien D. 4,5-đimetylhexa-2,4-đien.

Lời giải:

Đáp án: B

Bài 8: Ankađien Z có tên thay thế: 2,3-đimetylpenta-1,3-đien. Vậy CTCT của Z là

A. CH2=C(CH3)-CH(CH3)-CH=CH2

B. CH2=C(CH3)-C(CH3)=CH-CH3

C. CH2=C=C(CH3)-CH(CH3)-CH2

D. CH2=C(CH3)-CH2-C(CH3)=CH2

Lời giải:

Đáp án: B

Bài 9: C5H8 có số đồng phân ankin là:

A. 1 B. 2 C. 3 D. 4

Lời giải:

Đáp án: C

Bài 10: mang lại hợp chất hữu cơ tất cả CTCT CH≡C-CH(CH3)2 mang tên gọi là:

A. 2-metylbutin B. isopropyl axetilen C. 3-metylbut-1-in D. B hoặc C

Lời giải:

Đáp án: C

Bài 11: Tên thông thường của đúng theo chất gồm công thức : CH3 – C ≡ C – CH3 là

A. đimetylaxetilen B. but -3 –in C. but -3 –en D. but-2 –in.

Lời giải:

Đáp án: A

Bài 12: mang đến công thức cấu trúc của hợp chất sau: CH3-C≡C-CH2-C(Cl)(CH3)-CH3?

Tên điện thoại tư vấn đúng theo danh pháp IUPAC của hợp chất trên là:

A. 2 - clo - 2 - metylhex - 4 - in. B. 5 - clo - 5 - metylhex - 2 - in.

C. 2 - metyl - 2 - clohex - 4 - in. D. 5 - metyl - 5 - clohex - 2 - in.

Lời giải:

Đáp án: B

Bài 13: gọi tên hiđrocacbon tất cả công thức cấu tạo sau:

*

A. 6, 7 - đimetyloct - 4 - in. B. 2 - isopropylhept - 3 - in.

C. 2, 3 - đimetyloct - 4 - in. D. 6 - isopropylhept - 4 -in.

Lời giải:

Đáp án: C

Bài 14: Đimetylaxetilen có tên gọi là

A. propin B. but-1-in C. but-2-in D. but-2-en

Lời giải:

Đáp án: C

Phản ứng cộng của Anken, Ankađien, Ankin

A. Phương thức giải và Ví dụ minh họa

a/ Anken

Lý thuyết và cách thức giải

*Cộng Br2: CnH2n + Br2 → CnH2nBr2

- Anken : Br2 = 1 : 1 ( tỉ trọng về số mol hoặc thể tích )

- trọng lượng của bình tạo thêm là trọng lượng của hidrocabon không no bị hấp thụ.

- bội phản ứng cộng HX của anken tuân theo phép tắc macopnhicop.

*Cộng H2: CnH2n + H2 → CnH2n + 2

- Tỉ lệ làm phản ứng luôn là 1:1

- cân nặng trước cùng sau bội phản ứng luôn luôn bằng nhau

- Số mol sau phản nghịch ứng luôn luôn giảm ( vì chưng mất H2 ) → nH2 pư = nđ - ns

Ví dụ minh họa

Bài 1: Dẫn 3,36 lít hỗn hợp X có 2 anken là đồng đẳng tiếp đến vào bình nước brom dư, thấy trọng lượng bình tăng thêm 7,7 gam. Search CTPT của 2 anken ?

Hướng dẫn:

Số mol hỗn hợp X là: nX = 3,36/22,4 = 0,15 mol

Phương trình bội phản ứng:

*

Khối lượng bình brom tăng là trọng lượng của 2 anken: mX = 7,7 gam

*

Vậy CTPT của 2 anken tiếp nối là: C3H6 với C4H8

Bài 2: Dẫn thanh nhàn 6,72 lit (đktc) các thành phần hỗn hợp X tất cả etilen và propilen và dung dịch brom, hỗn hợp brom bị nhạt màu, và không tồn tại khí thoát ra. Cân nặng dung dịch sau làm phản ứng tắng 9,8 gam. Thành phần phần trăm theo thể tích của etilen vào X là

Hướng dẫn:

*

Bài 3: mang lại 4,48 lit tất cả hổn hợp X bao gồm etan, propan và propen qua hỗn hợp brom dư, thấy cân nặng bình brom tăng 4,2 gam. Lượng khí sót lại thoát thoát ra khỏi dung dịch rước đốt cháy hoàn toàn thu được 6,48 gam nước. Tính % thể tích các chất có trong hỗn hợp.

Hướng dẫn:

Số mol tất cả hổn hợp X là : nX = 4,48/22,4 = 0,2 mol

Khối lượng bình brom tăng là khối lượng của propen: mpropen = 4,2 gam ⇒ npropen = 4,2/ 42 = 0,1 mol

Phương trình phản nghịch ứng: C3H6 + Br2 → C3H6Br2

Khí bay ra gồm: C2H6 cùng C3H8.

Phương trình bội nghịch ứng đốt cháy C2H6 và C3H8

C2H6 + 7/2 O2 −tº→ 2CO2 + 3H2O

C3H8 + 5O2 −tº→ 3CO2 + 4H2O

nH2O = 6,48/18=0,36 mol

Gọi số mol của etan và propan thứu tự là x và y mol

Ta cóx + y = 0,2 – 0,1 = 0,1 (1); 3x + 4 y = 0,36 (2)

Từ (1), (2) ⇒ x = 0,04 với y = 0,06.

Phần trăm thể tích mỗi khí trong lếu láo hợp ban đầu là:

%Vetan = 0,04/0,2.100% = 20%; %Vpropan = 0,06/0,2.100% = 30%; %Vpropen = 0,1/0,2.100% = 50%

Bài 4: hỗn hợp khí X tất cả H2 và một anken có khả năng cộng HBr cho sản phẩm hữu cơ duy nhất. Tỉ khối của X đối với H2 bằng 9,1. Đun rét X tất cả xúc tác Ni, sau khoản thời gian phản ứng xảy ra hoàn toàn, thu được hỗn hợp khí Y không làm mất màu nước brom; tỉ khối của Y đối với H2 bằng 13. Tìm công thức cấu trúc của anken.

Hướng dẫn:

Gọi số mol hổn phù hợp X là 1mol

Ta tất cả Mtb X = 9,1. 2 = 18,2 ⇒ mX = 18,2. 1 = 18,2 g = mY

mà Mtb Y = 13. 2 = 26 ⇒ nY = 18,2/26= 0,7 mol

⇒ nH2 pư = 1 – 0,7 = 0,3 mol = nanken ⇒ nH2 bđ = 0,7 mol

Manken = (18,2 - 0,7.2)/0,3 = 14n ⇒ n = 4 ⇒ CTPT của anken là C4H8

Bài 5: hỗn hợp khí X bao gồm H2 cùng C2H4 gồm tỉ khối so với He là 3,75. Dẫn X qua Ni nung nóng, thu được tất cả hổn hợp khí Y gồm tỉ khối đối với He là 5. Tính hiệu suất của phản nghịch ứng hiđro hoá?

Hướng dẫn:

Ta bao gồm : Mtb X = 4. 3,75 = 15

*

Vậy công suất tính theo anken hoặc H2 cũng được

Giả sử: nX = 1mol ⇒ mX = 15. 1 = 15 g = mY

Mà Mtb Y = 5. 4 = 20 ⇒ nY = 15/20 = 0,75 mol ⇒ nH2 pư= 1 – 0,75 = 0,25 mol

⇒ H = 0,25/0,5.100% = 50 %

b/ Akadien và Akin

Lý thuyết và phương pháp giải

Giả sử X là láo lếu hợp ban sơ gồm CnH2n-2 và H2; Y là láo lếu hợp những chất sau p/ư

+ những phản ứng xảy ra:

CnH2n-2 + H2 → CnH2n.

CnH2n-2 + 2H2 → CnH2n+2.

+ hỗn hợp Y hoàn toàn có thể có: CnH2n, CnH2n+2, CnH2n-2 với H2 dư

+ quan hệ tình dục về khối lượng, ta có: mA = mB

+ quan hệ tình dục về số mol, ta có: nA– nB= nH2 bội nghịch ứng

+ Đốt cháy B cũng là đốt cháy A.

Ví dụ minh họa

Bài 1: mang đến m gam buta-1,3-đien chức năng vừa hết với (m - 17,5) gam H2 chiếm được a gam thành phầm cộng

a. Tính quý hiếm của m ?

b. quý hiếm của a là bao nhiêu ?

Hướng dẫn:

CH2=CH-CH=CH2 + 2H2 → CH3-CH2-CH2CH3

a. Số mol buta-1,3-đien: n1 = m/54 mol

Số mol H2 làm phản ứng: nH2 = (m-17,5)/2 mol

Theo phương trình bội phản ứng: 2n1 = nH2 ⇔ 2m/54 = (m-17,5)/2 ⇒ m = 18,9 gam

b. cực hiếm của a là:

a = m + m – 17,5 = 20,3 gam

Bài 2: Một các thành phần hỗn hợp X gồm 0,12 mol C2H2 với 0,18 mol H2. Cho X đi qua Ni nung nóng, sau một thời gian thu được các thành phần hỗn hợp khí Y. Mang lại Y vào bình đựng brom dư, thấy bình brom tăng m gam cùng thoát ra khí Z. Đốt cháy không còn Z với cho cục bộ sản phẩm cháy vào trong bình đựng hỗn hợp Ca(OH)2 dư thấy có 5 gam kết tủa lộ diện và thấy cân nặng dung dịch sút 1,36 gam. Tính cực hiếm của m ?

Hướng dẫn:

Khối lượng hỗn hợp X: mX = 0,12.26 + 0,18.2 = 3,48 g

Cho X đi qua Ni nung nóng:

Phương trình làm phản ứng: C2H2 + H2 → C2H4; C2H2 + 2H2 → C2H6

Hỗn hòa hợp Y gồm: C2H2, C2H4, C2H6 với H2

Cho Y qua bình đựng Br2 dư có C2H2, C2H4 bị duy trì lại. Hỗn hợp Z gồm: C2H6 và H2

Phương trình phản ứng: C2H4 + Br2 → C2H4Br2; C2H2 + 2Br2 → C2H2Br4

Đốt cháy Z nhận được CO2 với H2O:

nCO2 = nCaCO3 = 0,05 mol.

mdd giảm = m↓ - (mH2O + mCO2) ⇒ mH2O = 5 - 1,36 – 0,05.44 = 1,44 g

Số mol H2O: nH2O = 1,44/18 = 0,08 mol ⇒ mZ = 0,08.2 + 0,05.12 = 0,76 g

Khối lượng bình brom tăng: m = mX - mZ = 3,48 – 0,76 = 2,72 g

Bài 3: tất cả hổn hợp X bao gồm 0,15 mol CH4; 0,09 mol C2H2 và 0,2 mol H2. Nung lạnh X cùng với xúc tác Ni thu được hỗn hợp Y. Mang lại Y qua hỗn hợp brom dư thu được các thành phần hỗn hợp khí Z (có tỉ khối so với He là 4). Biết bình brom tăng 0,82 gam. Tính % thể tích của C2H6 trong tất cả hổn hợp Z.

Hướng dẫn:

Nung rét X cùng với Ni thu được tất cả hổn hợp Y gồm: C2H2, C2H4, C2H6, CH4, H2

Cho Y qua bình brom: C2H2, C2H4 bị giữ lại lại. Các thành phần hỗn hợp khí Z: C2H6, CH4, H2

Phương trình phản bội ứng: C2H4 + Br2 → C2H4Br2; C2H2 + 2Br2 → C2H2Br4

Khối lượng của các thành phần hỗn hợp X: mX = 0,15.16 + 0,09.26 + 0,2.2 = 5,14 g

Khối lượng của hỗn hợp Z : mZ = 5,14 – 0,82 = 4,32 g ⇒ nZ = 4,32/16 = 0,27 mol

nH2+C2H6 = 0,27 – 0,15 = 0,12 mol

Gọi số mol của H2 với C2H6 lần lượt là: x và y ta có: x + y = 0,12 mol

2x + 30 y + 16.0,15 = 4,32 ⇒ x + 15 y = 0,96 ⇒ x = 0,06 với y = 0,06

% thể tích của C2H6 trong tất cả hổn hợp Z: %VC2H6 = 0,06.100%/0,27 = 22,22%

B. Bài tập trắc nghiệm

Bài 1: Dẫn 0,2 mol một olefin A qua dung dịch brom dư, khối lượng bình sau phản ứng tăng 5,6 gam.Vậy công thức phân tử của A là:

A. C2H4 B. C3H6 C. C4H8 D. C5H10

Lời giải:

Đáp án: A

*

MX = 5,6/0,2 = 28 ⇒ n = 2

Bài 2: đến V lít một anken A làm việc đkc qua chai nước brom dư, gồm 8 g Br2 vẫn phản ứng đồng thời cân nặng bình tăng 2,8g. Còn mặt khác khi cho A bội nghịch ứng cùng với HBr chỉ thu được 1 mặt hàng . Cực hiếm của V với tên của A là:

A. 2,24 lít; propen B. 2,24 lít; etilen

C. 1,12 lít; but-1-en D. 1,12 lít; but-2-en

Lời giải:

Đáp án: D

CTPT A : CnH2n ; mãng cầu = nBr2 = 8/160 = 0,05 mol; MA = 2,8/0,05 = 56 ⇒ n = 4;

A phản nghịch ứng Br2 đến 1sản phẩm ⇒ A có kết cấu đối xứng.

Bài 3: Một hỗn hợp X hoàn toàn có thể tích 11,2 lít (đktc), X bao gồm 2 anken đồng đẳng sau đó nhau. Khi cho X qua nước Br2 dư thấy trọng lượng bình Br2 tăng 15,4g. Xác minh CTPT cùng số mol mỗi anken trong tất cả hổn hợp X.

A. 0,2 mol C2H4 cùng 0,3 mol C3H6 B. 0,2 mol C3H6 và 0,2 mol C4H8

C. 0,4 mol C2H4 và 0,1 mol C3H6 D. 0,3 mol C2H4 với 0,2 mol C3H6

Lời giải:

Đáp án: C

*

nX = 11,2/ 22,4 = 0,5 mol; mX = 15,4 gam

Mtb X = mX/nX = 15,4/0,5 = 30,8 ⇒ ntb = 2,2. 2

⇒ anken là: C2H4 và C3H6; nC2H4 : nC3H6 = 4:1

⇒ nC2H4 = 0,4 mol và nC3H6 = 0,1 mol

Bài 4: đến 10g các thành phần hỗn hợp khí X gồm etilen và etan qua dung dịch Br2 25% bao gồm 160g dd Br2 phản nghịch ứng. % trọng lượng của etilen trong tất cả hổn hợp là:

A. 70% B. 30% C. 35,5% D. 64,5%

Lời giải:

Đáp án: A

nC2H4 = nBr2 = 25.160/100.160 = 0,25 mol ⇒ %mC2H4 = 0,25.28/10.100% = 70%

Bài 5: lúc cho các thành phần hỗn hợp A tất cả anken cùng H2 trải qua xúc tác Ni nung nóng thu được hỗn hợp B. Điều xác định nào sau đây là đúng?

A. mãng cầu B B. na – nB = nH2 pư C. MA = MB D. mA > mB

Lời giải:

Đáp án: B

Bài 6: tất cả hổn hợp khí X tất cả 0,3 mol H2 và 0,1 mol propen. Nung X một thời hạn với xúc tác Ni thu được hỗn hợp khí Y gồm tỉ khối đối với H2 là 16. Tính số mol H2 bội nghịch ứng?

A. 0,15 mol B. 0,2 mol C. 0,25 mol D. 0,3 mol

Lời giải:

Đáp án: C

mX = 0,3.2 + 0,1.42 = 4,8 g ⇒ nY = 4,8/32 = 0,15 mol; nH2 pư = 0,4 – 0,15 = 0,25 mol

Bài 7: tất cả hổn hợp X có H2, C2H4 và C3H6 bao gồm tỉ khối đối với H2 là 9,25. đến 22,4 lít X (đktc) vào bình kín đáo có sẵn một không nhiều bột Ni. Đun nóng bình 1 thời gian, thu được hỗn hợp khí Y bao gồm tỉ khối so với H2 bằng 10. Tổng số mol H2 đang phản ứng là

A. 0,070 mol B. 0,015 mol

C. 0,075 mol D. 0,050 mol

Lời giải:

Đáp án: C

mX = 18,5.1 = 18,5 g; nY = 18,5/20 = 0,925 mol ⇒ nH2 pư = 1 – 0,925 = 0,075 mol

Bài 8: tất cả hổn hợp khí X có hiđro với một anken. Nung lạnh 24,64 lít các thành phần hỗn hợp X (đktc), có Ni làm cho xúc tác. Sau phản bội ứng thu được 25,3 gam hỗn hợp khí Y. Tỷ khối của X đối với H2 là:

A. 10,5 gam B. 11,5 gam C. 12 gam D. 12,5 gam

Lời giải:

Đáp án: B

nX = 26,64/22,4 = 1,1 mol; MX.nX = mX = mY ⇒ MX = 25,3/1,1 = 23; dX/H2 = 23/2 = 11,5

Bài 9: tất cả hổn hợp khí A chứa eilen với H2. Tỉ khối của A đối với hiđro là 7,5. Dẫn A đi qua chất xuc tác Ni nung rét thu được hh khí B có tỉ khối đối với hiđro là 9,0. Năng suất phản ứng cộng hiđro của etilen là:

A. 33,3% B. 66,7% C. 25% D. 50%

Lời giải:

Đáp án: A

Mtb A = 2. 7,5 = 15

trả sử mãng cầu = 1mol ⇒ mB = mA = 15. 1 = 15 g ; nC2H4 : nH2 = 1:1

cơ mà Mtb B = 9. 2 = 18 ⇒ nB = 0,83 mol ⇒ nH2 pư = 1 – 0,83 = 0,167 mol

⇒ H = 0,176/0,5 .100% = 33,3%

Bài 10: Đun lạnh 20,16 lít tất cả hổn hợp khí X bao gồm C2H4 và H2 cần sử dụng Ni xúc tác thì nhận được 13,44 lít hỗn hợp khí Y. Mang đến Y lội thật chậm qua bình đựng hỗn hợp Br2 dư thì thấy cân nặng bình tăng 2,8 gam. Hiệu suất phản ứng hidro hóa anken:

A. 40% B. 60% C. 65% D. 75%

Lời giải:

Đáp án: D

nX = 20,16/22,4 = 0,9 mol; nY = 13,44/22,4 = 0,6 mol; nH2 pư = 0,9 – 0,6 = 0,3 mol; nanken dư = 2,8/28 = 0,1 mol; nanken bđ = 0,1 + 0,3 = 0,4 mol ⇒ nH2 bđ = 0,5 mol ⇒ H = 0,3/0,4.100%=75%

Bài 11: đến H2 với 1 olefin rất có thể tích cân nhau qua Niken làm cho nóng ta được hỗn hợp A. Biết tỉ khối hơi của A đối với H2 là 23,2. Hiệu suất phản ứng hiđro hoá là 75%. Phương pháp phân tử olefin là

A. C2H4. B. C3H6. C. C4H8. D. C5H10.

Lời giải:

Đáp án: C

trả sử nanken = nH2 = 1 mol; mãng cầu = 2- 0,75 = 1,25 mol; Mđ = 23,2.2.1,25/2 = 14,5; 14.n + 2 = 2.14,5 ⇒ n = 4

Bài 12: 2,24 lít hỗn hợp X gồm buta–1,3–đien và penta–1–3-đien (đktc) bao gồm thể công dụng hết về tối đa bao nhiêu lít dung dịch brom 0,10 M ?

A. 2l B. 3l C.2,5l D.4l

Lời giải:

Đáp án: A

nBr2 = 2nX = 0,2 mol ⇒ VBr2 = 0,2/0,1 = 2 lít

Bài 13: chất nào sau đây không bắt buộc là thành phầm cộng giữa hỗn hợp brom với isopren (theo tỉ lệ mol 1:1) ?

A. CH2BrC(CH3)BrCH=CH2. B. CH2BrC(CH3)=CHCH2Br.

C. CH2BrCH=CHCH2CH2Br. D. CH2=C(CH3)CHBrCH2Br.

Lời giải:

Đáp án: C

Bài 14: Ankađien A + brom (dd) CH3C(CH3)BrCH=CHCH2Br. Vậy A là

A. 2-metylpenta-1,3-đien. B. 2-metylpenta-2,4-đien.

C. 4-metylpenta-1,3-đien. D. 2-metylbuta-1,3-đien.

Lời giải:

Đáp án: C

Bài 15: cho but-1-in bội phản ứng cộng với H2 (theo tỉ trọng mol 1:1 và xúc tác Pd/PbCO3) thu được sản phẩm hữu cơ mang tên là:

A. Butan B. But-2-en C. But-1-en D. A cùng C số đông đúng.

Lời giải:

Đáp án: C

Bài 16: cho những chất cơ học :

CH2=CH–CH2–CH3 (M)

CH≡C–CH2–CH3 (N)

CH2=C=CH–CH3 (P)

CH2=CH–CH=CH2 (Q)

CH2=C(CH3)–CH3 (R)

Những chất cho cùng một sản phẩm cộng hiđro là:

A. M, N, P, Q B. M, N, R C. M, N, R D. Q, R

Lời giải:

Đáp án: A

Bài 17: cho m gam propin công dụng với H2 dư (Ni, tº) chiếm được (m + 8) gam thành phầm hữu cơ Y. Cực hiếm của m là:

A. 80 gam. B. 40 gam C. 160 gam D. 120 gam

Lời giải:

Đáp án: A

Bài 18: cho 3,12 gam ankin X phản ứng với 0,1 mol H2 (xúc tác Pd/PbCO3, tº), thu được các thành phần hỗn hợp Y chỉ gồm hai hiđrocacbon. Công thức phân tử của X là

A. C2H2. B. C5H8. C. C4H6. D. C3H4.

Lời giải:

Đáp án: A

nankin > 0,1 mol; MX 2H2

Bài 19: các thành phần hỗn hợp X tất cả C2H2 với H2 gồm cùng số mol. đem một lượng các thành phần hỗn hợp X mang lại qua hóa học xúc tác nung nóng, thu được các thành phần hỗn hợp Y gồm C2H4, C2H6, C2H2 cùng H2. Sục Y vào hỗn hợp brom (dư) thì khối lượng bình brom tăng 10,8 gam với thoát ra 4,48 lít tất cả hổn hợp khí (đktc) có tỉ khối so với H2 là 8. Thể tích O2(đktc) phải để đốt cháy hoàn toàn hỗn hợp Y là:

A. 33,6 lít. B. 22,4 lít. C. 44,8 lít. D. 26,88 lít.

Lời giải:

Đáp án: A

mX = 10,8 + 16.0,2 = 14 g

mX = mC2H2 + mH2 = 26x + 2x = 28x = 14 ⇒ x = 0,5 mol;

nO2 = 0,5nH2 + 2,5nC2H2 = 0,5 + 2,5.0,5 = 1,5 mol ⇒ V = 33,6 lít

Bài 20: Đun nóng tất cả hổn hợp khí có 0,06 mol C2H2 với 0,04 mol H2 cùng với xúc tác Ni, sau một thời hạn thu được tất cả hổn hợp khí Y. Dẫn tổng thể hỗn phù hợp Y lội ung dung qua bình đựng dung dịch brom (dư) thì còn sót lại 0,448 lít hỗn hợp khí Z (ở đktc) có tỉ khối so với O2 là 0,5. Cân nặng bình hỗn hợp brom tăng là:

A. 1,04 gam. B. 1,64 gam. C.

Xem thêm: Công Dụng Khoai Lang Hàng Ngày, Khoai Lang, Thực Phẩm Rẻ Tiền Tốt Cho Sức Khỏe

1,20 gam. D. 1,32 gam

Lời giải:

Đáp án: D

mY = 0,06.26 + 0,04.2 = 1,64 g; mZ = 0,02.16 = 0,32 g; m↑ = mY – mZ = 1,64 – 0,32 = 1,32